About iridium;4-phenyl-2H-1,3-oxazine
iridium;4-phenyl-2H-1,3-oxazine (PubChem CID 58983204) has the molecular formula C10H8IrNO-
and a molecular weight of 350.40 g/mol. Its IUPAC name is iridium;4-phenyl-2H-1,3-oxazine.
Molecular Properties
| Compound Name | iridium;4-phenyl-2H-1,3-oxazine |
| PubChem CID | 58983204 |
| Molecular Formula | C10H8IrNO- |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | iridium;4-phenyl-2H-1,3-oxazine |
| SMILES | [Ir].[c-]1ccccc1C1=NCOC=C1 |
| InChI | InChI=1S/C10H8NO.Ir/c1-2-4-9(5-3-1)10-6-7-12-8-11-10;/h1-4,6-7H,8H2;/q-1; |
| InChIKey | PGQFFUSVOFFTOB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;4-phenyl-2H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;4-phenyl-2H-1,3-oxazine?
The IUPAC name of iridium;4-phenyl-2H-1,3-oxazine (CID 58983204) is iridium;4-phenyl-2H-1,3-oxazine.
What is the SMILES notation for iridium;4-phenyl-2H-1,3-oxazine?
The canonical SMILES for iridium;4-phenyl-2H-1,3-oxazine is [Ir].[c-]1ccccc1C1=NCOC=C1.
What is the InChIKey of iridium;4-phenyl-2H-1,3-oxazine?
The InChIKey is PGQFFUSVOFFTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8NO.Ir/c1-2-4-9(5-3-1)10-6-7-12-8-11-10;/h1-4,6-7H,8H2;/q-1;.
What are the key properties of iridium;4-phenyl-2H-1,3-oxazine?
iridium;4-phenyl-2H-1,3-oxazine has a molecular weight of 350.40 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;4-phenyl-2H-1,3-oxazine is sourced from PubChem (CID 58983204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).