C8H9NO — CID 91804282
5,8-dihydro-2H-3,1-benzoxazine (PubChem CID 91804282) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 5,8-dihydro-2H-3,1-benzoxazine.
| Compound Name | 5,8-dihydro-2H-3,1-benzoxazine |
|---|---|
| PubChem CID | 91804282 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 5,8-dihydro-2H-3,1-benzoxazine |
| SMILES | C1=CCC2=NCOC=C2C1 |
| InChI | InChI=1S/C8H9NO/c1-2-4-8-7(3-1)5-10-6-9-8/h1-2,5H,3-4,6H2 |
| InChIKey | BMEBXUCZDSVVAJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|