C28H42O7 — CID 70469126
[(2S,3S,5S,8S,9S,10R,13R,14S,17S)-2,3-diacetyloxy-17-ethyl-10,13-dimethyl-6-oxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl acetate (PubChem CID 70469126) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(2S,3S,5S,8S,9S,10R,13R,14S,17S)-2,3-diacetyloxy-17-ethyl-10,13-dimethyl-6-oxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl acetate.
| Compound Name | [(2S,3S,5S,8S,9S,10R,13R,14S,17S)-2,3-diacetyloxy-17-ethyl-10,13-dimethyl-6-oxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl acetate |
|---|---|
| PubChem CID | 70469126 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [(2S,3S,5S,8S,9S,10R,13R,14S,17S)-2,3-diacetyloxy-17-ethyl-10,13-dimethyl-6-oxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl acetate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@H]4C[C@@](COC(C)=O)(OC(C)=O)[C@@H](OC(C)=O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42O7/c1-7-19-8-9-21-20-12-24(32)23-13-28(35-18(4)31,15-33-16(2)29)25(34-17(3)30)14-27(23,6)22(20)10-11-26(19,21)5/h19-23,25H,7-15H2,1-6H3/t19-,20-,21-,22-,23+,25-,26+,27+,28-/m0/s1 |
| InChIKey | OMOLFPQRDVCXIS-FBWDVYJOSA-N |
| XLogP | 4.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|