N,N-diphenyl-trimethylsilyloxyphosphonamidic acid

C15H20NO3PSi — CID 70470849

IUPACN,N-diphenyl-trimethylsilyloxyphosphonamidic acid
SMILESC[Si](C)(C)OP(=O)(O)N(c1ccccc1)c1ccccc1
InChIInChI=1S/C15H20NO3PSi/c1-21(2,3)19-20(17,18)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,17,18)
InChIKeyVUHTXAMWZPNZCN-UHFFFAOYSA-N
MW321.39 g/mol
LogP4.78
Rot. Bonds5

About N,N-diphenyl-trimethylsilyloxyphosphonamidic acid

N,N-diphenyl-trimethylsilyloxyphosphonamidic acid (PubChem CID 70470849) has the molecular formula C15H20NO3PSi and a molecular weight of 321.39 g/mol. Its IUPAC name is N,N-diphenyl-trimethylsilyloxyphosphonamidic acid.

Molecular Properties

Compound NameN,N-diphenyl-trimethylsilyloxyphosphonamidic acid
PubChem CID70470849
Molecular FormulaC15H20NO3PSi
Molecular Weight321.39 g/mol
Exact Mass321.10
IUPAC NameN,N-diphenyl-trimethylsilyloxyphosphonamidic acid
SMILESC[Si](C)(C)OP(=O)(O)N(c1ccccc1)c1ccccc1
InChIInChI=1S/C15H20NO3PSi/c1-21(2,3)19-20(17,18)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,17,18)
InChIKeyVUHTXAMWZPNZCN-UHFFFAOYSA-N
XLogP4.78
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.39
LogP ≤ 54.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N,N-diphenyl-trimethylsilyloxyphosphonamidic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diphenyl-trimethylsilyloxyphosphonamidic acid?
The IUPAC name of N,N-diphenyl-trimethylsilyloxyphosphonamidic acid (CID 70470849) is N,N-diphenyl-trimethylsilyloxyphosphonamidic acid.
What is the SMILES notation for N,N-diphenyl-trimethylsilyloxyphosphonamidic acid?
The canonical SMILES for N,N-diphenyl-trimethylsilyloxyphosphonamidic acid is C[Si](C)(C)OP(=O)(O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of N,N-diphenyl-trimethylsilyloxyphosphonamidic acid?
The InChIKey is VUHTXAMWZPNZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20NO3PSi/c1-21(2,3)19-20(17,18)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,17,18).
What are the key properties of N,N-diphenyl-trimethylsilyloxyphosphonamidic acid?
N,N-diphenyl-trimethylsilyloxyphosphonamidic acid has a molecular weight of 321.39 g/mol, XLogP of 4.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenyl-trimethylsilyloxyphosphonamidic acid is sourced from PubChem (CID 70470849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).