C19H18ClF3O2S — CID 70473712
[3-(trifluoromethylsulfanyl)phenyl]methyl 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 70473712) has the molecular formula C19H18ClF3O2S and a molecular weight of 402.87 g/mol. Its IUPAC name is [3-(trifluoromethylsulfanyl)phenyl]methyl 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [3-(trifluoromethylsulfanyl)phenyl]methyl 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 70473712 |
| Molecular Formula | C19H18ClF3O2S |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [3-(trifluoromethylsulfanyl)phenyl]methyl 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OCc1cccc(SC(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClF3O2S/c1-12(2)17(14-6-8-15(20)9-7-14)18(24)25-11-13-4-3-5-16(10-13)26-19(21,22)23/h3-10,12,17H,11H2,1-2H3 |
| InChIKey | TXODMYGSCQOROP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |