C21H33ClFN3O — CID 70476311
N-cyclohexyl-2-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride (PubChem CID 70476311) has the molecular formula C21H33ClFN3O and a molecular weight of 397.97 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride.
| Compound Name | N-cyclohexyl-2-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70476311 |
| Molecular Formula | C21H33ClFN3O |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-cyclohexyl-2-[4-(4-fluorophenyl)butyl]piperazine-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCCC1)N1CCNCC1CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H32FN3O.ClH/c22-18-12-10-17(11-13-18)6-4-5-9-20-16-23-14-15-25(20)21(26)24-19-7-2-1-3-8-19;/h10-13,19-20,23H,1-9,14-16H2,(H,24,26);1H |
| InChIKey | DPPOJFPIPBOPMR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|