C16H26N2O — CID 70477262
3-(4-hexylpiperazin-1-yl)cyclohexa-2,4-dien-1-one (PubChem CID 70477262) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(4-hexylpiperazin-1-yl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3-(4-hexylpiperazin-1-yl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 70477262 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-(4-hexylpiperazin-1-yl)cyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCN1CCN(C2=CC(=O)CC=C2)CC1 |
| InChI | InChI=1S/C16H26N2O/c1-2-3-4-5-9-17-10-12-18(13-11-17)15-7-6-8-16(19)14-15/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | OSAPCCJQOUJEIS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|