C19H19NO4 — CID 70478233
3-(2-hydroxy-2-methylpropanoyl)-11-methyl-2,3-dihydrobenzo[b][1]benzazepine-5,6-dione (PubChem CID 70478233) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-(2-hydroxy-2-methylpropanoyl)-11-methyl-2,3-dihydrobenzo[b][1]benzazepine-5,6-dione.
| Compound Name | 3-(2-hydroxy-2-methylpropanoyl)-11-methyl-2,3-dihydrobenzo[b][1]benzazepine-5,6-dione |
|---|---|
| PubChem CID | 70478233 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(2-hydroxy-2-methylpropanoyl)-11-methyl-2,3-dihydrobenzo[b][1]benzazepine-5,6-dione |
| SMILES | Cn1c2c(c(=O)c(=O)c3ccccc31)=CC(C(=O)C(C)(C)O)CC=2 |
| InChI | InChI=1S/C19H19NO4/c1-19(2,24)18(23)11-8-9-15-13(10-11)17(22)16(21)12-6-4-5-7-14(12)20(15)3/h4-7,9-11,24H,8H2,1-3H3 |
| InChIKey | IAKISAXQXCJRBB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|