C18H19NO2 — CID 70479782
1-phenyl-7-propoxy-3,4-dihydroisoquinolin-3-ol (PubChem CID 70479782) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-phenyl-7-propoxy-3,4-dihydroisoquinolin-3-ol.
| Compound Name | 1-phenyl-7-propoxy-3,4-dihydroisoquinolin-3-ol |
|---|---|
| PubChem CID | 70479782 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-phenyl-7-propoxy-3,4-dihydroisoquinolin-3-ol |
| SMILES | CCCOc1ccc2c(c1)C(c1ccccc1)=NC(O)C2 |
| InChI | InChI=1S/C18H19NO2/c1-2-10-21-15-9-8-14-11-17(20)19-18(16(14)12-15)13-6-4-3-5-7-13/h3-9,12,17,20H,2,10-11H2,1H3 |
| InChIKey | ZSYFGXRVGOYIER-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |