C32H44N2O10 — CID 70482526
(1E,6E)-4-amino-4-(3-aminopropyl)-1,7-bis[3-methoxy-4-(1-methoxyethoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 70482526) has the molecular formula C32H44N2O10 and a molecular weight of 616.71 g/mol. Its IUPAC name is (1E,6E)-4-amino-4-(3-aminopropyl)-1,7-bis[3-methoxy-4-(1-methoxyethoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-amino-4-(3-aminopropyl)-1,7-bis[3-methoxy-4-(1-methoxyethoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 70482526 |
| Molecular Formula | C32H44N2O10 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | (1E,6E)-4-amino-4-(3-aminopropyl)-1,7-bis[3-methoxy-4-(1-methoxyethoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)C(N)(CCCN)C(=O)/C=C/c2ccc(OCOC(C)OC)c(OC)c2)ccc1OCOC(C)OC |
| InChI | InChI=1S/C32H44N2O10/c1-22(37-3)41-20-43-26-12-8-24(18-28(26)39-5)10-14-30(35)32(34,16-7-17-33)31(36)15-11-25-9-13-27(29(19-25)40-6)44-21-42-23(2)38-4/h8-15,18-19,22-23H,7,16-17,20-21,33-34H2,1-6H3/b14-10+,15-11+ |
| InChIKey | ZEFBTWHIJWWZEM-WFYKWJGLSA-N |
| XLogP | 3.70 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|