[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate

C14H15N3O5 — CID 70483338

IUPAC[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate
SMILESCOC(=O)Oc1c(Nc2ccccc2[N+](=O)[O-])c(C)cn1C
InChIInChI=1S/C14H15N3O5/c1-9-8-16(2)13(22-14(18)21-3)12(9)15-10-6-4-5-7-11(10)17(19)20/h4-8,15H,1-3H3
InChIKeyVEMMFCHADRCJAK-UHFFFAOYSA-N
MW305.29 g/mol
LogP3.13
Rot. Bonds4

About [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate

[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate (PubChem CID 70483338) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate.

Molecular Properties

Compound Name[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate
PubChem CID70483338
Molecular FormulaC14H15N3O5
Molecular Weight305.29 g/mol
Exact Mass305.10
IUPAC Name[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate
SMILESCOC(=O)Oc1c(Nc2ccccc2[N+](=O)[O-])c(C)cn1C
InChIInChI=1S/C14H15N3O5/c1-9-8-16(2)13(22-14(18)21-3)12(9)15-10-6-4-5-7-11(10)17(19)20/h4-8,15H,1-3H3
InChIKeyVEMMFCHADRCJAK-UHFFFAOYSA-N
XLogP3.13
TPSA95.63 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.29
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate?
The IUPAC name of [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate (CID 70483338) is [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate.
What is the SMILES notation for [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate?
The canonical SMILES for [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate is COC(=O)Oc1c(Nc2ccccc2[N+](=O)[O-])c(C)cn1C.
What is the InChIKey of [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate?
The InChIKey is VEMMFCHADRCJAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O5/c1-9-8-16(2)13(22-14(18)21-3)12(9)15-10-6-4-5-7-11(10)17(19)20/h4-8,15H,1-3H3.
What are the key properties of [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate?
[1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate has a molecular weight of 305.29 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-dimethyl-3-(2-nitroanilino)pyrrol-2-yl] methyl carbonate is sourced from PubChem (CID 70483338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).