About [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate
[5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate (PubChem CID 70493581) has the molecular formula C16H17N3O8
and a molecular weight of 379.33 g/mol. Its IUPAC name is [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate |
| PubChem CID | 70493581 |
| Molecular Formula | C16H17N3O8 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(OC(=O)OC)N1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O8/c1-9-13(26-15(20)24-3)18(11-7-5-6-8-12(11)19(22)23)14(10(2)17-9)27-16(21)25-4/h5-8,17H,1-4H3 |
| InChIKey | SPACJZCKCMQYHC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate?
The IUPAC name of [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate (CID 70493581) is [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate.
What is the SMILES notation for [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate?
The canonical SMILES for [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate is COC(=O)OC1=C(C)NC(C)=C(OC(=O)OC)N1c1ccccc1[N+](=O)[O-].
What is the InChIKey of [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate?
The InChIKey is SPACJZCKCMQYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O8/c1-9-13(26-15(20)24-3)18(11-7-5-6-8-12(11)19(22)23)14(10(2)17-9)27-16(21)25-4/h5-8,17H,1-4H3.
What are the key properties of [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate?
[5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate has a molecular weight of 379.33 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methoxycarbonyloxy-2,6-dimethyl-4-(2-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate is sourced from PubChem (CID 70493581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).