C17H19N3O8 — CID 70494767
[5-ethoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate (PubChem CID 70494767) has the molecular formula C17H19N3O8 and a molecular weight of 393.35 g/mol. Its IUPAC name is [5-ethoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate.
| Compound Name | [5-ethoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70494767 |
| Molecular Formula | C17H19N3O8 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [5-ethoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] methyl carbonate |
| SMILES | CCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OC)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N3O8/c1-5-26-17(22)28-15-11(3)18-10(2)14(27-16(21)25-4)19(15)12-7-6-8-13(9-12)20(23)24/h6-9,18H,5H2,1-4H3 |
| InChIKey | HUEOSBBHZNDXDG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|