C26H37N3O8 — CID 70492328
[5-decoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] ethyl carbonate (PubChem CID 70492328) has the molecular formula C26H37N3O8 and a molecular weight of 519.60 g/mol. Its IUPAC name is [5-decoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] ethyl carbonate.
| Compound Name | [5-decoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70492328 |
| Molecular Formula | C26H37N3O8 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | [5-decoxycarbonyloxy-2,6-dimethyl-4-(3-nitrophenyl)-1H-pyrazin-3-yl] ethyl carbonate |
| SMILES | CCCCCCCCCCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OCC)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H37N3O8/c1-5-7-8-9-10-11-12-13-17-35-26(31)37-24-20(4)27-19(3)23(36-25(30)34-6-2)28(24)21-15-14-16-22(18-21)29(32)33/h14-16,18,27H,5-13,17H2,1-4H3 |
| InChIKey | XWMCBTQLKBOEKA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|