C13H14Cl2O2 — CID 70483576
2-[(2,2-dichloro-3,3-dimethylcyclopropyl)methyl]benzoic acid (PubChem CID 70483576) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-[(2,2-dichloro-3,3-dimethylcyclopropyl)methyl]benzoic acid.
| Compound Name | 2-[(2,2-dichloro-3,3-dimethylcyclopropyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 70483576 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-[(2,2-dichloro-3,3-dimethylcyclopropyl)methyl]benzoic acid |
| SMILES | CC1(C)C(Cc2ccccc2C(=O)O)C1(Cl)Cl |
| InChI | InChI=1S/C13H14Cl2O2/c1-12(2)10(13(12,14)15)7-8-5-3-4-6-9(8)11(16)17/h3-6,10H,7H2,1-2H3,(H,16,17) |
| InChIKey | HSXDSAGAPPQKTI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|