C11H16N2O6 — CID 70483814
4-[(4-ethyl-2,6-dioxopiperazin-1-yl)methoxy]-4-oxobutanoic acid (PubChem CID 70483814) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[(4-ethyl-2,6-dioxopiperazin-1-yl)methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(4-ethyl-2,6-dioxopiperazin-1-yl)methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70483814 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[(4-ethyl-2,6-dioxopiperazin-1-yl)methoxy]-4-oxobutanoic acid |
| SMILES | CCN1CC(=O)N(COC(=O)CCC(=O)O)C(=O)C1 |
| InChI | InChI=1S/C11H16N2O6/c1-2-12-5-8(14)13(9(15)6-12)7-19-11(18)4-3-10(16)17/h2-7H2,1H3,(H,16,17) |
| InChIKey | UJSYLGIHDJRMOX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|