C28H33NO3 — CID 70483974
(2R,3R)-3-(4,4-diphenylbutylamino)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 70483974) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (2R,3R)-3-(4,4-diphenylbutylamino)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3R)-3-(4,4-diphenylbutylamino)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70483974 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (2R,3R)-3-(4,4-diphenylbutylamino)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc2c(cc1OC)C[C@@H](O)C(NCCCC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C28H33NO3/c1-31-27-18-22-16-25(26(30)17-23(22)19-28(27)32-2)29-15-9-14-24(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,18-19,24-26,29-30H,9,14-17H2,1-2H3/t25?,26-/m1/s1 |
| InChIKey | FNZVIVVWSLVJPD-FXDYGKIASA-N |
| XLogP | 4.73 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|