C4H10NO7P2-3 — CID 7048550
(4-hydroxy-4,4-diphosphonatobutyl)azanium (PubChem CID 7048550) has the molecular formula C4H10NO7P2-3 and a molecular weight of 246.07 g/mol. Its IUPAC name is (4-hydroxy-4,4-diphosphonatobutyl)azanium.
| Compound Name | (4-hydroxy-4,4-diphosphonatobutyl)azanium |
|---|---|
| PubChem CID | 7048550 |
| Molecular Formula | C4H10NO7P2-3 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | (4-hydroxy-4,4-diphosphonatobutyl)azanium |
| SMILES | [NH3+]CCCC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C4H13NO7P2/c5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12)/p-3 |
| InChIKey | OGSPWJRAVKPPFI-UHFFFAOYSA-K |
| XLogP | -4.52 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|