C31H33N3O6S — CID 70485571
5-O-[2-[benzyl(methyl)amino]-1-thiophen-2-ylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70485571) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is 5-O-[2-[benzyl(methyl)amino]-1-thiophen-2-ylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[benzyl(methyl)amino]-1-thiophen-2-ylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70485571 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 5-O-[2-[benzyl(methyl)amino]-1-thiophen-2-ylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(c2cccs2)C(C)N(C)Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H33N3O6S/c1-19-26(30(35)39-5)28(23-13-9-14-24(17-23)34(37)38)27(20(2)32-19)31(36)40-29(25-15-10-16-41-25)21(3)33(4)18-22-11-7-6-8-12-22/h6-17,21,28-29,32H,18H2,1-5H3 |
| InChIKey | MYMWTGCOHTYNIM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|