2-formylbenzenesulfonic acid

C7H6O4S — CID 7049

IUPAC2-formylbenzenesulfonic acid
SMILESO=Cc1ccccc1S(=O)(=O)O
InChIInChI=1S/C7H6O4S/c8-5-6-3-1-2-4-7(6)12(9,10)11/h1-5H,(H,9,10,11)
InChIKeySHHKMWMIKILKQW-UHFFFAOYSA-N
MW186.19 g/mol
LogP0.75
Rot. Bonds2

About 2-formylbenzenesulfonic acid

2-formylbenzenesulfonic acid (PubChem CID 7049) has the molecular formula C7H6O4S and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-formylbenzenesulfonic acid.

Molecular Properties

Compound Name2-formylbenzenesulfonic acid
PubChem CID7049
Molecular FormulaC7H6O4S
Molecular Weight186.19 g/mol
Exact Mass186.00
IUPAC Name2-formylbenzenesulfonic acid
SMILESO=Cc1ccccc1S(=O)(=O)O
InChIInChI=1S/C7H6O4S/c8-5-6-3-1-2-4-7(6)12(9,10)11/h1-5H,(H,9,10,11)
InChIKeySHHKMWMIKILKQW-UHFFFAOYSA-N
XLogP0.75
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.19
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-formylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-formylbenzenesulfonic acid?
The IUPAC name of 2-formylbenzenesulfonic acid (CID 7049) is 2-formylbenzenesulfonic acid.
What is the SMILES notation for 2-formylbenzenesulfonic acid?
The canonical SMILES for 2-formylbenzenesulfonic acid is O=Cc1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-formylbenzenesulfonic acid?
The InChIKey is SHHKMWMIKILKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4S/c8-5-6-3-1-2-4-7(6)12(9,10)11/h1-5H,(H,9,10,11).
What are the key properties of 2-formylbenzenesulfonic acid?
2-formylbenzenesulfonic acid has a molecular weight of 186.19 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbenzenesulfonic acid is sourced from PubChem (CID 7049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).