C17H19NO2 — CID 70491785
16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol (PubChem CID 70491785) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol.
| Compound Name | 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
|---|---|
| PubChem CID | 70491785 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
| SMILES | OC1=C2C3=C(CC=CC3=CCC3=C2C(O)CCC3)CN1 |
| InChI | InChI=1S/C17H19NO2/c19-13-6-2-4-11-8-7-10-3-1-5-12-9-18-17(20)16(14(10)12)15(11)13/h1,3,7,13,18-20H,2,4-6,8-9H2 |
| InChIKey | FRQDZEQNYCCCIK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |