C22H29N5O4 — CID 70493892
methyl 3-[3-(diethylamino)propyl]-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate (PubChem CID 70493892) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is methyl 3-[3-(diethylamino)propyl]-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 3-[3-(diethylamino)propyl]-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70493892 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | methyl 3-[3-(diethylamino)propyl]-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate |
| SMILES | CCN(CC)CCCc1cnc2n1C(c1cccc([N+](=O)[O-])c1)C(C(=O)OC)=C(C)N2 |
| InChI | InChI=1S/C22H29N5O4/c1-5-25(6-2)12-8-11-18-14-23-22-24-15(3)19(21(28)31-4)20(26(18)22)16-9-7-10-17(13-16)27(29)30/h7,9-10,13-14,20H,5-6,8,11-12H2,1-4H3,(H,23,24) |
| InChIKey | PYRIEVUJOBBWOE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|