C16H16N4O5 — CID 70495353
methyl 3-(hydroxymethyl)-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate (PubChem CID 70495353) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is methyl 3-(hydroxymethyl)-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 3-(hydroxymethyl)-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70495353 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | methyl 3-(hydroxymethyl)-7-methyl-5-(3-nitrophenyl)-5,8-dihydroimidazo[1,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2ncc(CO)n2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N4O5/c1-9-13(15(22)25-2)14(10-4-3-5-11(6-10)20(23)24)19-12(8-21)7-17-16(19)18-9/h3-7,14,21H,8H2,1-2H3,(H,17,18) |
| InChIKey | MGLUOQOWIKMXJZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|