C15H13NO5S2 — CID 70494415
3-(benzenesulfonyl)-6-methoxy-1H-indole-2-sulfinic acid (PubChem CID 70494415) has the molecular formula C15H13NO5S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-methoxy-1H-indole-2-sulfinic acid.
| Compound Name | 3-(benzenesulfonyl)-6-methoxy-1H-indole-2-sulfinic acid |
|---|---|
| PubChem CID | 70494415 |
| Molecular Formula | C15H13NO5S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 3-(benzenesulfonyl)-6-methoxy-1H-indole-2-sulfinic acid |
| SMILES | COc1ccc2c(S(=O)(=O)c3ccccc3)c(S(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C15H13NO5S2/c1-21-10-7-8-12-13(9-10)16-15(22(17)18)14(12)23(19,20)11-5-3-2-4-6-11/h2-9,16H,1H3,(H,17,18) |
| InChIKey | WBCMSFXGMQUIAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|