C15H12LiNO5S2 — CID 70493068
lithium 3-(benzenesulfonyl)-5-methoxy-1H-indole-2-sulfinate (PubChem CID 70493068) has the molecular formula C15H12LiNO5S2 and a molecular weight of 357.34 g/mol. Its IUPAC name is lithium 3-(benzenesulfonyl)-5-methoxy-1H-indole-2-sulfinate.
| Compound Name | lithium 3-(benzenesulfonyl)-5-methoxy-1H-indole-2-sulfinate |
|---|---|
| PubChem CID | 70493068 |
| Molecular Formula | C15H12LiNO5S2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | lithium 3-(benzenesulfonyl)-5-methoxy-1H-indole-2-sulfinate |
| SMILES | COc1ccc2[nH]c(S(=O)[O-])c(S(=O)(=O)c3ccccc3)c2c1.[Li+] |
| InChI | InChI=1S/C15H13NO5S2.Li/c1-21-10-7-8-13-12(9-10)14(15(16-13)22(17)18)23(19,20)11-5-3-2-4-6-11;/h2-9,16H,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | LXANSNYANSZXAC-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|