C17H14N2O6S — CID 70495804
phenyl N-[2-(1,2-oxazol-5-ylmethoxy)phenyl]sulfonylcarbamate (PubChem CID 70495804) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is phenyl N-[2-(1,2-oxazol-5-ylmethoxy)phenyl]sulfonylcarbamate.
| Compound Name | phenyl N-[2-(1,2-oxazol-5-ylmethoxy)phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 70495804 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | phenyl N-[2-(1,2-oxazol-5-ylmethoxy)phenyl]sulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)c1ccccc1OCc1ccno1)Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O6S/c20-17(24-13-6-2-1-3-7-13)19-26(21,22)16-9-5-4-8-15(16)23-12-14-10-11-18-25-14/h1-11H,12H2,(H,19,20) |
| InChIKey | NMUJYUPVBDWWPE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |