C19H17N3O2 — CID 70497493
[3-(benzotriazol-2-yl)-2-prop-2-enylphenyl] 2-methylprop-2-enoate (PubChem CID 70497493) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is [3-(benzotriazol-2-yl)-2-prop-2-enylphenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(benzotriazol-2-yl)-2-prop-2-enylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70497493 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | [3-(benzotriazol-2-yl)-2-prop-2-enylphenyl] 2-methylprop-2-enoate |
| SMILES | C=CCc1c(OC(=O)C(=C)C)cccc1-n1nc2ccccc2n1 |
| InChI | InChI=1S/C19H17N3O2/c1-4-8-14-17(11-7-12-18(14)24-19(23)13(2)3)22-20-15-9-5-6-10-16(15)21-22/h4-7,9-12H,1-2,8H2,3H3 |
| InChIKey | FOYRIHDGCNIRIC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|