C9H18N2O3 — CID 70499003
[4-(2-hydroxypropyl)piperazin-1-yl] acetate (PubChem CID 70499003) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is [4-(2-hydroxypropyl)piperazin-1-yl] acetate.
| Compound Name | [4-(2-hydroxypropyl)piperazin-1-yl] acetate |
|---|---|
| PubChem CID | 70499003 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [4-(2-hydroxypropyl)piperazin-1-yl] acetate |
| SMILES | CC(=O)ON1CCN(CC(C)O)CC1 |
| InChI | InChI=1S/C9H18N2O3/c1-8(12)7-10-3-5-11(6-4-10)14-9(2)13/h8,12H,3-7H2,1-2H3 |
| InChIKey | ONUQWCUUXTXWKF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |