C12H19N3O4 — CID 70501467
(2S)-2-amino-6-[(5-hydroxy-2-methyl-4-oxo-1-pyridinyl)amino]hexanoic acid (PubChem CID 70501467) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-2-amino-6-[(5-hydroxy-2-methyl-4-oxo-1-pyridinyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(5-hydroxy-2-methyl-4-oxo-1-pyridinyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 70501467 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-2-amino-6-[(5-hydroxy-2-methyl-4-oxo-1-pyridinyl)amino]hexanoic acid |
| SMILES | Cc1cc(=O)c(O)cn1NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-8-6-10(16)11(17)7-15(8)14-5-3-2-4-9(13)12(18)19/h6-7,9,14,17H,2-5,13H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | CULGMQJFKZNOKY-VIFPVBQESA-N |
| XLogP | -0.01 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|