C26H43NO4 — CID 70505986
2,3-dihydroxypropyl 2-[2-(tetradec-4-enylamino)phenyl]propanoate (PubChem CID 70505986) has the molecular formula C26H43NO4 and a molecular weight of 433.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[2-(tetradec-4-enylamino)phenyl]propanoate.
| Compound Name | 2,3-dihydroxypropyl 2-[2-(tetradec-4-enylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 70505986 |
| Molecular Formula | C26H43NO4 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[2-(tetradec-4-enylamino)phenyl]propanoate |
| SMILES | CCCCCCCCCC=CCCCNc1ccccc1C(C)C(=O)OCC(O)CO |
| InChI | InChI=1S/C26H43NO4/c1-3-4-5-6-7-8-9-10-11-12-13-16-19-27-25-18-15-14-17-24(25)22(2)26(30)31-21-23(29)20-28/h11-12,14-15,17-18,22-23,27-29H,3-10,13,16,19-21H2,1-2H3 |
| InChIKey | RUFHXOABMIBOHM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|