C32H47NO3 — CID 70507370
(E)-12,13-bis(2-hydroxyphenyl)-N-pentylpentadec-12-enamide (PubChem CID 70507370) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (E)-12,13-bis(2-hydroxyphenyl)-N-pentylpentadec-12-enamide.
| Compound Name | (E)-12,13-bis(2-hydroxyphenyl)-N-pentylpentadec-12-enamide |
|---|---|
| PubChem CID | 70507370 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (E)-12,13-bis(2-hydroxyphenyl)-N-pentylpentadec-12-enamide |
| SMILES | CCCCCNC(=O)CCCCCCCCCC/C(=C(/CC)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C32H47NO3/c1-3-5-18-25-33-32(36)24-13-11-9-7-6-8-10-12-19-27(29-21-15-17-23-31(29)35)26(4-2)28-20-14-16-22-30(28)34/h14-17,20-23,34-35H,3-13,18-19,24-25H2,1-2H3,(H,33,36)/b27-26+ |
| InChIKey | LHJSTUJKWDPGSQ-CYYJNZCTSA-N |
| XLogP | 8.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|