C24H26N2OS — CID 70508500
(18-methyl-8-thia-18-azatetracyclo[13.5.0.02,7.09,14]icosa-1(15),2(7),3,5,9,11,13-heptaen-4-yl)-pyrrolidin-1-ylmethanone (PubChem CID 70508500) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is (18-methyl-8-thia-18-azatetracyclo[13.5.0.02,7.09,14]icosa-1(15),2(7),3,5,9,11,13-heptaen-4-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (18-methyl-8-thia-18-azatetracyclo[13.5.0.02,7.09,14]icosa-1(15),2(7),3,5,9,11,13-heptaen-4-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 70508500 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (18-methyl-8-thia-18-azatetracyclo[13.5.0.02,7.09,14]icosa-1(15),2(7),3,5,9,11,13-heptaen-4-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CN1CCC2=C(CC1)c1cc(C(=O)N3CCCC3)ccc1Sc1ccccc12 |
| InChI | InChI=1S/C24H26N2OS/c1-25-14-10-18-19(11-15-25)21-16-17(24(27)26-12-4-5-13-26)8-9-23(21)28-22-7-3-2-6-20(18)22/h2-3,6-9,16H,4-5,10-15H2,1H3 |
| InChIKey | QIFOCIGSGOYKJW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|