C24H44N2O4 — CID 70510317
ethyl 10-[2-(2,4-dioxoimidazolidin-1-yl)ethyl]-8-propyltetradecanoate (PubChem CID 70510317) has the molecular formula C24H44N2O4 and a molecular weight of 424.63 g/mol. Its IUPAC name is ethyl 10-[2-(2,4-dioxoimidazolidin-1-yl)ethyl]-8-propyltetradecanoate.
| Compound Name | ethyl 10-[2-(2,4-dioxoimidazolidin-1-yl)ethyl]-8-propyltetradecanoate |
|---|---|
| PubChem CID | 70510317 |
| Molecular Formula | C24H44N2O4 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | ethyl 10-[2-(2,4-dioxoimidazolidin-1-yl)ethyl]-8-propyltetradecanoate |
| SMILES | CCCCC(CCN1CC(=O)NC1=O)CC(CCC)CCCCCCC(=O)OCC |
| InChI | InChI=1S/C24H44N2O4/c1-4-7-13-21(16-17-26-19-22(27)25-24(26)29)18-20(12-5-2)14-10-8-9-11-15-23(28)30-6-3/h20-21H,4-19H2,1-3H3,(H,25,27,29) |
| InChIKey | NUGFSZWVHCSWLV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|