C22H29NO4S — CID 70512318
1-[2-[(6-methoxy-3,4-dihydro-2H-thiochromen-7-yl)oxy]ethylamino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 70512318) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 1-[2-[(6-methoxy-3,4-dihydro-2H-thiochromen-7-yl)oxy]ethylamino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[2-[(6-methoxy-3,4-dihydro-2H-thiochromen-7-yl)oxy]ethylamino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 70512318 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[2-[(6-methoxy-3,4-dihydro-2H-thiochromen-7-yl)oxy]ethylamino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | COc1cc2c(cc1OCCNCC(O)COc1ccccc1C)SCCC2 |
| InChI | InChI=1S/C22H29NO4S/c1-16-6-3-4-8-19(16)27-15-18(24)14-23-9-10-26-21-13-22-17(7-5-11-28-22)12-20(21)25-2/h3-4,6,8,12-13,18,23-24H,5,7,9-11,14-15H2,1-2H3 |
| InChIKey | ZGEILAFLWINXHH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|