C13H21N3OS — CID 70517200
3-[3-(cyclohexylmethyl)-1,2-thiazol-5-yl]-1,1-dimethylurea (PubChem CID 70517200) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-[3-(cyclohexylmethyl)-1,2-thiazol-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[3-(cyclohexylmethyl)-1,2-thiazol-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70517200 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[3-(cyclohexylmethyl)-1,2-thiazol-5-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cc(CC2CCCCC2)ns1 |
| InChI | InChI=1S/C13H21N3OS/c1-16(2)13(17)14-12-9-11(15-18-12)8-10-6-4-3-5-7-10/h9-10H,3-8H2,1-2H3,(H,14,17) |
| InChIKey | XWNSVGSIZQCFQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |