C27H19NO4 — CID 70517323
[(1R)-1-(6,11-dioxotetracen-2-yl)ethyl] N-phenylcarbamate (PubChem CID 70517323) has the molecular formula C27H19NO4 and a molecular weight of 421.45 g/mol. Its IUPAC name is [(1R)-1-(6,11-dioxotetracen-2-yl)ethyl] N-phenylcarbamate.
| Compound Name | [(1R)-1-(6,11-dioxotetracen-2-yl)ethyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 70517323 |
| Molecular Formula | C27H19NO4 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(1R)-1-(6,11-dioxotetracen-2-yl)ethyl] N-phenylcarbamate |
| SMILES | C[C@@H](OC(=O)Nc1ccccc1)c1ccc2cc3c(cc2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C27H19NO4/c1-16(32-27(31)28-20-7-3-2-4-8-20)17-11-12-18-14-23-24(15-19(18)13-17)26(30)22-10-6-5-9-21(22)25(23)29/h2-16H,1H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | WZKYYZHHTWVSMI-MRXNPFEDSA-N |
| XLogP | 5.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|