C27H34N2O — CID 70518289
2,5-bis[1-(4-amino-2-ethylphenyl)propylidene]cyclopentan-1-one (PubChem CID 70518289) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is 2,5-bis[1-(4-amino-2-ethylphenyl)propylidene]cyclopentan-1-one.
| Compound Name | 2,5-bis[1-(4-amino-2-ethylphenyl)propylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 70518289 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2,5-bis[1-(4-amino-2-ethylphenyl)propylidene]cyclopentan-1-one |
| SMILES | CCC(=C1CCC(=C(CC)c2ccc(N)cc2CC)C1=O)c1ccc(N)cc1CC |
| InChI | InChI=1S/C27H34N2O/c1-5-17-15-19(28)9-11-23(17)21(7-3)25-13-14-26(27(25)30)22(8-4)24-12-10-20(29)16-18(24)6-2/h9-12,15-16H,5-8,13-14,28-29H2,1-4H3 |
| InChIKey | UORWFOPEMVLVGX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|