About 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one
3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one (PubChem CID 70521379) has the molecular formula C25H32N2O
and a molecular weight of 376.54 g/mol. Its IUPAC name is 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one.
Molecular Properties
| Compound Name | 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one |
| PubChem CID | 70521379 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one |
| SMILES | CCC(=CC(=O)C=C(CC)c1ccc(N)cc1CC)c1ccc(N)cc1CC |
| InChI | InChI=1S/C25H32N2O/c1-5-17-13-21(26)9-11-24(17)19(7-3)15-23(28)16-20(8-4)25-12-10-22(27)14-18(25)6-2/h9-16H,5-8,26-27H2,1-4H3 |
| InChIKey | YSFGMQQQLVYMTC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one?
The IUPAC name of 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one (CID 70521379) is 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one.
What is the SMILES notation for 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one?
The canonical SMILES for 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one is CCC(=CC(=O)C=C(CC)c1ccc(N)cc1CC)c1ccc(N)cc1CC.
What is the InChIKey of 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one?
The InChIKey is YSFGMQQQLVYMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O/c1-5-17-13-21(26)9-11-24(17)19(7-3)15-23(28)16-20(8-4)25-12-10-22(27)14-18(25)6-2/h9-16H,5-8,26-27H2,1-4H3.
What are the key properties of 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one?
3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one has a molecular weight of 376.54 g/mol, XLogP of 5.83, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(4-amino-2-ethylphenyl)nona-3,6-dien-5-one is sourced from PubChem (CID 70521379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).