C25H41NO2 — CID 70518919
(1S,5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-1-(3-methylbutylamino)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 70518919) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (1S,5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-1-(3-methylbutylamino)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (1S,5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-1-(3-methylbutylamino)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 70518919 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (1S,5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-1-(3-methylbutylamino)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC(C)CCN[C@H]1C=CC[C@@H]2CC[C@H]3[C@@H]4CC[C@H](C(=O)O)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C25H41NO2/c1-16(2)13-15-26-22-7-5-6-17-8-9-18-19-10-11-21(23(27)28)24(19,3)14-12-20(18)25(17,22)4/h5,7,16-22,26H,6,8-15H2,1-4H3,(H,27,28)/t17-,18+,19+,20+,21-,22+,24+,25+/m1/s1 |
| InChIKey | YQOGOKFPXDNXBO-ORQKKAAJSA-N |
| XLogP | 5.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|