C29H51NO4 — CID 70520538
(5R,8S,9S,10S,11R,13S,14S,17S)-1,1-diethoxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 70520538) has the molecular formula C29H51NO4 and a molecular weight of 477.73 g/mol. Its IUPAC name is (5R,8S,9S,10S,11R,13S,14S,17S)-1,1-diethoxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (5R,8S,9S,10S,11R,13S,14S,17S)-1,1-diethoxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 70520538 |
| Molecular Formula | C29H51NO4 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.38 |
| IUPAC Name | (5R,8S,9S,10S,11R,13S,14S,17S)-1,1-diethoxy-10,13-dimethyl-11-(3-methylbutylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CCOC1(OCC)CCC[C@@H]2CC[C@@H]3[C@H]([C@H](NCCC(C)C)C[C@]4(C)[C@@H](C(=O)O)CC[C@@H]34)[C@]21C |
| InChI | InChI=1S/C29H51NO4/c1-7-33-29(34-8-2)16-9-10-20-11-12-21-22-13-14-23(26(31)32)27(22,5)18-24(25(21)28(20,29)6)30-17-15-19(3)4/h19-25,30H,7-18H2,1-6H3,(H,31,32)/t20-,21+,22+,23-,24-,25-,27+,28+/m1/s1 |
| InChIKey | AIYDCTNKUGLMLX-DFCTTYPMSA-N |
| XLogP | 6.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|