C23H27FO3S — CID 70519390
methyl 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoate (PubChem CID 70519390) has the molecular formula C23H27FO3S and a molecular weight of 402.53 g/mol. Its IUPAC name is methyl 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoate.
| Compound Name | methyl 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 70519390 |
| Molecular Formula | C23H27FO3S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | methyl 4-[3-[2-(4-fluoro-3-methylphenyl)-4,6-dimethylphenyl]prop-2-enylsulfanyl]-3-hydroxybutanoate |
| SMILES | COC(=O)CC(O)CSCC=Cc1c(C)cc(C)cc1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C23H27FO3S/c1-15-10-16(2)20(6-5-9-28-14-19(25)13-23(26)27-4)21(11-15)18-7-8-22(24)17(3)12-18/h5-8,10-12,19,25H,9,13-14H2,1-4H3 |
| InChIKey | KZTYXZXOTRSZBI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|