C28H30O3S — CID 138965073
ethyl (E)-3-hydroxy-7-tritylsulfanylhept-4-enoate (PubChem CID 138965073) has the molecular formula C28H30O3S and a molecular weight of 446.61 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-7-tritylsulfanylhept-4-enoate.
| Compound Name | ethyl (E)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
|---|---|
| PubChem CID | 138965073 |
| Molecular Formula | C28H30O3S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | ethyl (E)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
| SMILES | CCOC(=O)CC(O)/C=C/CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30O3S/c1-2-31-27(30)22-26(29)20-12-13-21-32-28(23-14-6-3-7-15-23,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h3-12,14-20,26,29H,2,13,21-22H2,1H3/b20-12+ |
| InChIKey | UVYOECTWNFETQR-UDWIEESQSA-N |
| XLogP | 5.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|