C33H32O3S — CID 10896477
benzyl (E,3R)-3-hydroxy-7-tritylsulfanylhept-4-enoate (PubChem CID 10896477) has the molecular formula C33H32O3S and a molecular weight of 508.68 g/mol. Its IUPAC name is benzyl (E,3R)-3-hydroxy-7-tritylsulfanylhept-4-enoate.
| Compound Name | benzyl (E,3R)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
|---|---|
| PubChem CID | 10896477 |
| Molecular Formula | C33H32O3S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | benzyl (E,3R)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
| SMILES | O=C(C[C@@H](O)/C=C/CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H32O3S/c34-31(25-32(35)36-26-27-15-5-1-6-16-27)23-13-14-24-37-33(28-17-7-2-8-18-28,29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1-13,15-23,31,34H,14,24-26H2/b23-13+/t31-/m0/s1 |
| InChIKey | XOYAJBHQMCVXRB-QRHGRHGXSA-N |
| XLogP | 7.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|