C25H22O3S — CID 54689000
4-hydroxy-5-phenethylsulfanyl-2,2-diphenyl-3H-pyran-6-one (PubChem CID 54689000) has the molecular formula C25H22O3S and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-hydroxy-2,2-diphenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one.
| Compound Name | 4-hydroxy-5-phenethylsulfanyl-2,2-diphenyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54689000 |
| Molecular Formula | C25H22O3S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-hydroxy-2,2-diphenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one |
| SMILES | C1C(=C(C(=O)OC1(C2=CC=CC=C2)C3=CC=CC=C3)SCCC4=CC=CC=C4)O |
| InChI | InChI=1S/C25H22O3S/c26-22-18-25(20-12-6-2-7-13-20,21-14-8-3-9-15-21)28-24(27)23(22)29-17-16-19-10-4-1-5-11-19/h1-15,26H,16-18H2 |
| InChIKey | VUAHMYDBJUZKRX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 563 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |