C30H32O3S — CID 54682306
5-(2-tert-butyl-5-methyl-phenyl)sulfanyl-4-hydroxy-2-phenethyl-2-phenyl-3H-pyran-6-one (PubChem CID 54682306) has the molecular formula C30H32O3S and a molecular weight of 472.60 g/mol. Its IUPAC name is 5-(2-tert-butyl-5-methylphenyl)sulfanyl-4-hydroxy-2-phenyl-2-(2-phenylethyl)-3H-pyran-6-one.
| Compound Name | 5-(2-tert-butyl-5-methyl-phenyl)sulfanyl-4-hydroxy-2-phenethyl-2-phenyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54682306 |
| Molecular Formula | C30H32O3S |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 5-(2-tert-butyl-5-methylphenyl)sulfanyl-4-hydroxy-2-phenyl-2-(2-phenylethyl)-3H-pyran-6-one |
| SMILES | CC1=CC(=C(C=C1)C(C)(C)C)SC2=C(CC(OC2=O)(CCC3=CC=CC=C3)C4=CC=CC=C4)O |
| InChI | InChI=1S/C30H32O3S/c1-21-15-16-24(29(2,3)4)26(19-21)34-27-25(31)20-30(33-28(27)32,23-13-9-6-10-14-23)18-17-22-11-7-5-8-12-22/h5-16,19,31H,17-18,20H2,1-4H3 |
| InChIKey | BSOWYJGYVNURDM-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 726 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |