C16H13N5O4S — CID 7052195
2-methoxy-4-[(6R)-3-(3-nitrophenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenol (PubChem CID 7052195) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is 2-methoxy-4-[(6R)-3-(3-nitrophenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenol.
| Compound Name | 2-methoxy-4-[(6R)-3-(3-nitrophenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenol |
|---|---|
| PubChem CID | 7052195 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-methoxy-4-[(6R)-3-(3-nitrophenyl)-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenol |
| SMILES | COc1cc([C@@H]2Nn3c(nnc3-c3cccc([N+](=O)[O-])c3)S2)ccc1O |
| InChI | InChI=1S/C16H13N5O4S/c1-25-13-8-10(5-6-12(13)22)15-19-20-14(17-18-16(20)26-15)9-3-2-4-11(7-9)21(23)24/h2-8,15,19,22H,1H3/t15-/m1/s1 |
| InChIKey | YEQSAJDQLBEPSP-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|