C15H11N5O2S — CID 7052177
(6R)-3-(4-nitrophenyl)-6-phenyl-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 7052177) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is (6R)-3-(4-nitrophenyl)-6-phenyl-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | (6R)-3-(4-nitrophenyl)-6-phenyl-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 7052177 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (6R)-3-(4-nitrophenyl)-6-phenyl-5,6-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc3n2N[C@@H](c2ccccc2)S3)cc1 |
| InChI | InChI=1S/C15H11N5O2S/c21-20(22)12-8-6-10(7-9-12)13-16-17-15-19(13)18-14(23-15)11-4-2-1-3-5-11/h1-9,14,18H/t14-/m1/s1 |
| InChIKey | MXEGKNOWKNXKRT-CQSZACIVSA-N |
| XLogP | 3.20 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|