C17H14N4O4S2 — CID 41145435
(5S)-5-(benzenesulfonylmethyl)-3-(4-nitrophenyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 41145435) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (5S)-5-(benzenesulfonylmethyl)-3-(4-nitrophenyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole.
| Compound Name | (5S)-5-(benzenesulfonylmethyl)-3-(4-nitrophenyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
|---|---|
| PubChem CID | 41145435 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (5S)-5-(benzenesulfonylmethyl)-3-(4-nitrophenyl)-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc3n2[C@H](CS(=O)(=O)c2ccccc2)CS3)cc1 |
| InChI | InChI=1S/C17H14N4O4S2/c22-21(23)13-8-6-12(7-9-13)16-18-19-17-20(16)14(10-26-17)11-27(24,25)15-4-2-1-3-5-15/h1-9,14H,10-11H2/t14-/m0/s1 |
| InChIKey | MHTLFQVCUHKZGT-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|