C13H12N4O5S2 — CID 41145429
(3S)-7-amino-3-[(4-nitrophenyl)sulfonylmethyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 41145429) has the molecular formula C13H12N4O5S2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (3S)-7-amino-3-[(4-nitrophenyl)sulfonylmethyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | (3S)-7-amino-3-[(4-nitrophenyl)sulfonylmethyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 41145429 |
| Molecular Formula | C13H12N4O5S2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (3S)-7-amino-3-[(4-nitrophenyl)sulfonylmethyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Nc1cc(=O)n2c(n1)SC[C@H]2CS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N4O5S2/c14-11-5-12(18)16-9(6-23-13(16)15-11)7-24(21,22)10-3-1-8(2-4-10)17(19)20/h1-5,9H,6-7,14H2/t9-/m0/s1 |
| InChIKey | RCZJZIZQWWXEKZ-VIFPVBQESA-N |
| XLogP | 0.85 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|