C14H11N5O3S2 — CID 39835890
(12R)-12-[(4-nitrophenyl)sulfanylmethyl]-10-thia-1,3,4,8-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one (PubChem CID 39835890) has the molecular formula C14H11N5O3S2 and a molecular weight of 361.41 g/mol. Its IUPAC name is (12R)-12-[(4-nitrophenyl)sulfanylmethyl]-10-thia-1,3,4,8-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one.
| Compound Name | (12R)-12-[(4-nitrophenyl)sulfanylmethyl]-10-thia-1,3,4,8-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one |
|---|---|
| PubChem CID | 39835890 |
| Molecular Formula | C14H11N5O3S2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (12R)-12-[(4-nitrophenyl)sulfanylmethyl]-10-thia-1,3,4,8-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,8-trien-7-one |
| SMILES | O=c1nc2n(c3[nH]ncc13)[C@H](CSc1ccc([N+](=O)[O-])cc1)CS2 |
| InChI | InChI=1S/C14H11N5O3S2/c20-13-11-5-15-17-12(11)18-9(7-24-14(18)16-13)6-23-10-3-1-8(2-4-10)19(21)22/h1-5,9H,6-7H2,(H,15,17)/t9-/m1/s1 |
| InChIKey | RQPGFFMWHWSXFG-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|